Products 3002502-34-0
CAS 3002502-34-0 is the registry number for Tert-butyl 3-bromo-2,6-difluorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-bromo-2,6-difluorobenzoate (CAS 3002502-34-0) is a chemical compound with the molecular formula C11H11BrF2O2 and a molecular weight of 293.10 g/mol. IUPAC name: tert-butyl 3-bromo-2,6-difluorobenzoate. InChIKey: DMNOBCDTLHRVAA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrF2O2 |
|---|---|
| Molecular weight | 293.10 g/mol |
| IUPAC name | tert-butyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | DMNOBCDTLHRVAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)