Products 1226809-67-1
CAS 1226809-67-1 is the registry number for 2-(10-(Naphthalen-2-yl)anthracen-9-yl)dibenzo[b,d]furan, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(10-naphthalen-2-ylanthracen-9-yl)dibenzofuran (CAS 1226809-67-1) is a chemical compound with the molecular formula C36H22O and a molecular weight of 470.6 g/mol. IUPAC name: 2-(10-naphthalen-2-ylanthracen-9-yl)dibenzofuran. InChIKey: UYEFMAMRNKBMMP-UHFFFAOYSA-N.
| Molecular formula | C36H22O |
|---|---|
| Molecular weight | 470.6 g/mol |
| IUPAC name | 2-(10-naphthalen-2-ylanthracen-9-yl)dibenzofuran |
| InChIKey | UYEFMAMRNKBMMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=CC7=C(C=C6)OC8=CC=CC=C87 |
Computed by PubChem (NCBI)