CAS 1627916-48-6 is the registry number for 2-(10-Phenylanthracen-9-yl)naphtho[2,3-b]benzofuran, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(10-phenylanthracen-9-yl)naphtho[2,3-b][1]benzofuran (CAS 1627916-48-6) is a chemical compound with the molecular formula C36H22O and a molecular weight of 470.6 g/mol. IUPAC name: 2-(10-phenylanthracen-9-yl)naphtho[2,3-b][1]benzofuran. InChIKey: DFRPRIUFLDNBKD-UHFFFAOYSA-N.
| Molecular formula | C36H22O |
|---|---|
| Molecular weight | 470.6 g/mol |
| IUPAC name | 2-(10-phenylanthracen-9-yl)naphtho[2,3-b][1]benzofuran |
| InChIKey | DFRPRIUFLDNBKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC6=C(C=C5)OC7=CC8=CC=CC=C8C=C76 |
Computed by PubChem (NCBI)