CAS 1226810-14-5 is the registry number for 9H,9'H-2,3'-Bicarbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-(9H-carbazol-3-yl)-9H-carbazole (CAS 1226810-14-5) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 2-(9H-carbazol-3-yl)-9H-carbazole. InChIKey: LSUOFHQPCBPIPH-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-(9H-carbazol-3-yl)-9H-carbazole |
| InChIKey | LSUOFHQPCBPIPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)C4=CC5=C(C=C4)NC6=CC=CC=C65 |
Computed by PubChem (NCBI)