Products 1226857-48-2

CAS 1226857-48-2 is the registry number for Ethyl 2-(2'-fluoro-[1,1'-biphenyl]-2-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2-[2-(2-fluorophenyl)phenyl]acetate (CAS 1226857-48-2) is a chemical compound with the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. IUPAC name: ethyl 2-[2-(2-fluorophenyl)phenyl]acetate. InChIKey: MAEKYSUFNXXRIL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15FO2
Molecular weight258.29 g/mol
IUPAC nameethyl 2-[2-(2-fluorophenyl)phenyl]acetate
InChIKeyMAEKYSUFNXXRIL-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CC=CC=C1C2=CC=CC=C2F

Computed by PubChem (NCBI)