Products 2270911-79-8

CAS 2270911-79-8 is the registry number for 3-[2-(2-Fluoro-4-methyl-phenyl)-ethyl]-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[2-(2-fluoro-4-methylphenyl)ethyl]benzoic acid (CAS 2270911-79-8) is a chemical compound with the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. IUPAC name: 3-[2-(2-fluoro-4-methylphenyl)ethyl]benzoic acid. InChIKey: VTXHTWHDNLIVLF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15FO2
Molecular weight258.29 g/mol
IUPAC name3-[2-(2-fluoro-4-methylphenyl)ethyl]benzoic acid
InChIKeyVTXHTWHDNLIVLF-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)CCC2=CC(=CC=C2)C(=O)O)F

Computed by PubChem (NCBI)