Products 1226857-74-4

CAS 1226857-74-4 is the registry number for Ethyl 2,2-difluoro-2-(2'-fluoro-[1,1'-biphenyl]-2-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2,2-difluoro-2-[2-(2-fluorophenyl)phenyl]acetate (CAS 1226857-74-4) is a chemical compound with the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. IUPAC name: ethyl 2,2-difluoro-2-[2-(2-fluorophenyl)phenyl]acetate. InChIKey: VIMRTJHLNDCGJK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13F3O2
Molecular weight294.27 g/mol
IUPAC nameethyl 2,2-difluoro-2-[2-(2-fluorophenyl)phenyl]acetate
InChIKeyVIMRTJHLNDCGJK-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC=CC=C1C2=CC=CC=C2F)(F)F

Computed by PubChem (NCBI)