Products 877607-36-8
CAS 877607-36-8 is the registry number for methyl 2-{4-[3-(trifluoromethyl)phenyl]phenyl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[4-[3-(trifluoromethyl)phenyl]phenyl]acetate (CAS 877607-36-8) is a chemical compound with the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. IUPAC name: methyl 2-[4-[3-(trifluoromethyl)phenyl]phenyl]acetate. InChIKey: ORLVRYQFGMUBSD-UHFFFAOYSA-N.
| Molecular formula | C16H13F3O2 |
|---|---|
| Molecular weight | 294.27 g/mol |
| IUPAC name | methyl 2-[4-[3-(trifluoromethyl)phenyl]phenyl]acetate |
| InChIKey | ORLVRYQFGMUBSD-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)