CAS 1226898-95-8 is the registry number for 2-Chloro-6-methyl-7,8-dihydro-1,6-naphthyridin-5(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one (CAS 1226898-95-8) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 2-chloro-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one. InChIKey: FKSSVJHAWRIFGJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 2-chloro-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one |
| InChIKey | FKSSVJHAWRIFGJ-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1=O)C=CC(=N2)Cl |
Computed by PubChem (NCBI)