CAS 1227267-08-4 is the registry number for 4,6-Dichloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-4,6-dichloropyrrolo[2,3-b]pyridine (CAS 1227267-08-4) is a chemical compound with the molecular formula C13H8Cl2N2O2S and a molecular weight of 327.2 g/mol. IUPAC name: 1-(benzenesulfonyl)-4,6-dichloropyrrolo[2,3-b]pyridine. InChIKey: AYYBAEZQXCQONH-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O2S |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4,6-dichloropyrrolo[2,3-b]pyridine |
| InChIKey | AYYBAEZQXCQONH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=C(C=C3Cl)Cl |
Computed by PubChem (NCBI)