CAS 326901-92-2 appears in our catalog under these names: WDR5-IN-6, 95%, WDR5-IN-6/ 99.69% (existing batch purity), WDR5–IN–6, WDR5-IN-6 99%, WDR5-IN-6. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1-(2,5-dichlorophenyl)sulfonylbenzimidazole (CAS 326901-92-2) is a chemical compound with the molecular formula C13H8Cl2N2O2S and a molecular weight of 327.2 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)sulfonylbenzimidazole. InChIKey: PXUHMEZESKEPKJ-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O2S |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)sulfonylbenzimidazole |
| InChIKey | PXUHMEZESKEPKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2S(=O)(=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)