CAS 1227370-65-1 appears in our catalog under these names: [4-(methanesulfonylmethyl)phenyl]methanol, 97%, (4-(Methanesulfonylmethyl)phenyl)methanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
[4-(methylsulfonylmethyl)phenyl]methanol (CAS 1227370-65-1) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: [4-(methylsulfonylmethyl)phenyl]methanol. InChIKey: SYQAHAMSZLVYEQ-UHFFFAOYSA-N.
| Molecular formula | C9H12O3S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | [4-(methylsulfonylmethyl)phenyl]methanol |
| InChIKey | SYQAHAMSZLVYEQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC=C(C=C1)CO |
Computed by PubChem (NCBI)