CAS 28987-67-9 is the registry number for 2,3,4-Trimethylbenzenesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3,4-trimethylbenzenesulfonic acid (CAS 28987-67-9) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: 2,3,4-trimethylbenzenesulfonic acid. InChIKey: XNJVIJQATFJERB-UHFFFAOYSA-N.
| Molecular formula | C9H12O3S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2,3,4-trimethylbenzenesulfonic acid |
| InChIKey | XNJVIJQATFJERB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)O)C)C |
Computed by PubChem (NCBI)