Products 28987-67-9

CAS 28987-67-9 is the registry number for 2,3,4-Trimethylbenzenesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,3,4-trimethylbenzenesulfonic acid (CAS 28987-67-9) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: 2,3,4-trimethylbenzenesulfonic acid. InChIKey: XNJVIJQATFJERB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O3S
Molecular weight200.26 g/mol
IUPAC name2,3,4-trimethylbenzenesulfonic acid
InChIKeyXNJVIJQATFJERB-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)S(=O)(=O)O)C)C

Computed by PubChem (NCBI)