CAS 1227580-07-5 appears in our catalog under these names: 5-Chloro-6-fluoro-1h-indole-3-carbaldehyde, 95%, 5-Chloro-6-fluoro-1H-indole-3-carbaldehyde, 97%, 5-Chloro-6-fluoro-1H-indole-3-carbaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
5-chloro-6-fluoro-1H-indole-3-carbaldehyde (CAS 1227580-07-5) is a chemical compound with the molecular formula C9H5ClFNO and a molecular weight of 197.59 g/mol. IUPAC name: 5-chloro-6-fluoro-1H-indole-3-carbaldehyde. InChIKey: BCBXXZSUPVGPFQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO |
|---|---|
| Molecular weight | 197.59 g/mol |
| IUPAC name | 5-chloro-6-fluoro-1H-indole-3-carbaldehyde |
| InChIKey | BCBXXZSUPVGPFQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)F)NC=C2C=O |
Computed by PubChem (NCBI)