Products 2002638-39-1
CAS 2002638-39-1 appears in our catalog under these names: 5-(4-Chloro-3-ffluorophenyl)-1,3-oxazole, 95%, 5-(4-Chloro-3-ffluorophenyl)-1,3-oxazole, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-(4-chloro-3-fluorophenyl)-1,3-oxazole (CAS 2002638-39-1) is a chemical compound with the molecular formula C9H5ClFNO and a molecular weight of 197.59 g/mol. IUPAC name: 5-(4-chloro-3-fluorophenyl)-1,3-oxazole. InChIKey: LCVORFSOLDSVID-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO |
|---|---|
| Molecular weight | 197.59 g/mol |
| IUPAC name | 5-(4-chloro-3-fluorophenyl)-1,3-oxazole |
| InChIKey | LCVORFSOLDSVID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=CO2)F)Cl |
Computed by PubChem (NCBI)