Products 1227585-37-6
CAS 1227585-37-6 is the registry number for 5-Bromo-2-(bromomethyl)-3-(trifluoromethyl)pyridine, 97%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-2-(bromomethyl)-3-(trifluoromethyl)pyridine (CAS 1227585-37-6) is a chemical compound with the molecular formula C7H4Br2F3N and a molecular weight of 318.92 g/mol. IUPAC name: 5-bromo-2-(bromomethyl)-3-(trifluoromethyl)pyridine. InChIKey: CDMPOYLOXGKPSN-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3N |
|---|---|
| Molecular weight | 318.92 g/mol |
| IUPAC name | 5-bromo-2-(bromomethyl)-3-(trifluoromethyl)pyridine |
| InChIKey | CDMPOYLOXGKPSN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)CBr)Br |
Computed by PubChem (NCBI)