Products 2385322-16-5
CAS 2385322-16-5 is the registry number for 2,3-dibromo-6-methyl-5-(trifluoromethyl)pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
2,3-dibromo-6-methyl-5-(trifluoromethyl)pyridine (CAS 2385322-16-5) is a chemical compound with the molecular formula C7H4Br2F3N and a molecular weight of 318.92 g/mol. IUPAC name: 2,3-dibromo-6-methyl-5-(trifluoromethyl)pyridine. InChIKey: CSUUUOWVHNZLEG-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3N |
|---|---|
| Molecular weight | 318.92 g/mol |
| IUPAC name | 2,3-dibromo-6-methyl-5-(trifluoromethyl)pyridine |
| InChIKey | CSUUUOWVHNZLEG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1C(F)(F)F)Br)Br |
Computed by PubChem (NCBI)