CAS 122760-31-0 appears in our catalog under these names: 2-Phenyl-2-(trimethylsilyl)ethanol, 95%, 2–phenyl–2–(trimethylsilyl)ethanol, 2-Phenyl-2-(trimethylsilyl)ethan-1-ol. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
2-phenyl-2-trimethylsilylethanol (CAS 122760-31-0) is a chemical compound with the molecular formula C11H18OSi and a molecular weight of 194.34 g/mol. IUPAC name: 2-phenyl-2-trimethylsilylethanol. InChIKey: CRJTTYGVPSXCRZ-UHFFFAOYSA-N.
| Molecular formula | C11H18OSi |
|---|---|
| Molecular weight | 194.34 g/mol |
| IUPAC name | 2-phenyl-2-trimethylsilylethanol |
| InChIKey | CRJTTYGVPSXCRZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(CO)C1=CC=CC=C1 |
Computed by PubChem (NCBI)