Products 57337-80-1
CAS 57337-80-1 is the registry number for (4-(methoxymethyl)phenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
[4-(methoxymethyl)phenyl]-trimethylsilane (CAS 57337-80-1) is a chemical compound with the molecular formula C11H18OSi and a molecular weight of 194.34 g/mol. IUPAC name: [4-(methoxymethyl)phenyl]-trimethylsilane. InChIKey: ZSPVSDGSXJINKR-UHFFFAOYSA-N.
| Molecular formula | C11H18OSi |
|---|---|
| Molecular weight | 194.34 g/mol |
| IUPAC name | [4-(methoxymethyl)phenyl]-trimethylsilane |
| InChIKey | ZSPVSDGSXJINKR-UHFFFAOYSA-N |
| SMILES | COCC1=CC=C(C=C1)[Si](C)(C)C |
Computed by PubChem (NCBI)