Products 1227601-39-9
CAS 1227601-39-9 is the registry number for 2-[6-(4-fluorophenyl)pyridin-3-yl]aceticacid, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-[6-(4-fluorophenyl)-3-pyridinyl]acetic acid (CAS 1227601-39-9) is a chemical compound with the molecular formula C13H10FNO2 and a molecular weight of 231.22 g/mol. IUPAC name: 2-[6-(4-fluorophenyl)-3-pyridinyl]acetic acid. InChIKey: DSVMHEXVQVMOHA-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO2 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 2-[6-(4-fluorophenyl)-3-pyridinyl]acetic acid |
| InChIKey | DSVMHEXVQVMOHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)CC(=O)O)F |
Computed by PubChem (NCBI)