CAS 1227625-83-3 appears in our catalog under these names: 2-Nitro-4-(trifluoromethyl)cinnamic acid, 95%, 2-Nitro-4-(trifluoromethyl)cinnamic acid, 98%, 2-Nitro-4-(trifluoromethyl)cinnamic acid, 2-Nitro-4-(trifluoromethyl)cinnamic acid, min. 95 %, 250 mg, 2-Nitro-4-(trifluoromethyl)cinnamic acid, min. 95 %, 500 mg. Offered by: Combi-blocks, AmBeed, Biosynth, Roth. Available pack sizes: 5g, 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg, 2g.
(E)-3-[2-nitro-4-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 1227625-83-3) is a chemical compound with the molecular formula C10H6F3NO4 and a molecular weight of 261.15 g/mol. IUPAC name: (E)-3-[2-nitro-4-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: VQOSRJGJWKVLKW-DUXPYHPUSA-N.
| Molecular formula | C10H6F3NO4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | (E)-3-[2-nitro-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | VQOSRJGJWKVLKW-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])/C=C/C(=O)O |
Computed by PubChem (NCBI)