CAS 35999-53-2 appears in our catalog under these names: 4,4,4-Trifluoro-1-(4-nitrophenyl)-1,3-butanedione, 95%, 4,4,4-TRIFLUORO-1-(4-NITROPHENYL)-1,3-BUTANEDIONE, 95%, 95%, 4,4,4-TRIFLUORO-1-(4-NITROPHENYL)-1,3-BUTANEDIONE, 98%, 4,4,4-Trifluoro-1-(4-nitrophenyl)butane-1,3-dione, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
4,4,4-trifluoro-1-(4-nitrophenyl)butane-1,3-dione (CAS 35999-53-2) is a chemical compound with the molecular formula C10H6F3NO4 and a molecular weight of 261.15 g/mol. IUPAC name: 4,4,4-trifluoro-1-(4-nitrophenyl)butane-1,3-dione. InChIKey: CDSAMNVLRSHLPN-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO4 |
|---|---|
| Molecular weight | 261.15 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(4-nitrophenyl)butane-1,3-dione |
| InChIKey | CDSAMNVLRSHLPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)