CAS 1227664-12-1 is the registry number for Methyl 5-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 1227664-12-1) is a chemical compound with the molecular formula C18H21BO4S and a molecular weight of 344.2 g/mol. IUPAC name: methyl 5-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: UCCHYVZXYUDANO-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4S |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | methyl 5-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | UCCHYVZXYUDANO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC(=C2)C3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)