CAS 1361215-96-4 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(4-(phenylsulfonyl)phenyl)-1,3,2-dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-(4-(phenylsulfonyl)phenyl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-[4-(benzenesulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1361215-96-4) is a chemical compound with the molecular formula C18H21BO4S and a molecular weight of 344.2 g/mol. IUPAC name: 2-[4-(benzenesulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OBPKMLXPEKVJMY-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4S |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | 2-[4-(benzenesulfonyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OBPKMLXPEKVJMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)