Products 1227666-13-8
CAS 1227666-13-8 appears in our catalog under these names: Nateglinide D5, Nateglinide-d5, Nateglinide-d5, >95% (HPLC), Nateglinide-d5 (phenyl-d5), 99 atom % D, min 98% Chemical Purity, Nateglinide–d5. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, TargetMol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,01g.
(2R)-3-(2,3,4,5,6-pentadeuteriophenyl)-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid (CAS 1227666-13-8) is a chemical compound with the molecular formula C19H27NO3 and a molecular weight of 322.5 g/mol. IUPAC name: (2R)-3-(2,3,4,5,6-pentadeuteriophenyl)-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid. InChIKey: OELFLUMRDSZNSF-ZBRYERADSA-N.
| Molecular formula | C19H27NO3 |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | (2R)-3-(2,3,4,5,6-pentadeuteriophenyl)-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid |
| InChIKey | OELFLUMRDSZNSF-ZBRYERADSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@H](C(=O)O)NC(=O)C2CCC(CC2)C(C)C)[2H])[2H] |
Computed by PubChem (NCBI)