CAS 122776-87-8 appears in our catalog under these names: 1-(Chloromethyl)-2,4-bis(propan-2-yl)benzene, 95%, 1-(Chloromethyl)-2,4-bis(propan-2-yl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(chloromethyl)-2,4-di(propan-2-yl)benzene (CAS 122776-87-8) is a chemical compound with the molecular formula C13H19Cl and a molecular weight of 210.74 g/mol. IUPAC name: 1-(chloromethyl)-2,4-di(propan-2-yl)benzene. InChIKey: XSHGGIWBIKGBBK-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl |
|---|---|
| Molecular weight | 210.74 g/mol |
| IUPAC name | 1-(chloromethyl)-2,4-di(propan-2-yl)benzene |
| InChIKey | XSHGGIWBIKGBBK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)CCl)C(C)C |
Computed by PubChem (NCBI)