CAS 19387-83-8 appears in our catalog under these names: 5-tert-Butyl-2-chloromethyl-1,3-dimethyl-benzene, 95%, Xylometazoline EP Impurity B, 4-Tert-butyl-2,6-dimethylbenzylchloroide, 95%, 2-(Chloromethyl)-5-(1,1-dimethylethyl)-1,3-dimethylbenzene, 4-Tert-butyl-2,6-dimethylbenzylchloroide. Offered by: Combi-blocks, Chemat Brand, AmBeed, Mikromol, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, on request, 0,5g, 2g.
5-tert-butyl-2-(chloromethyl)-1,3-dimethylbenzene (CAS 19387-83-8) is a chemical compound with the molecular formula C13H19Cl and a molecular weight of 210.74 g/mol. IUPAC name: 5-tert-butyl-2-(chloromethyl)-1,3-dimethylbenzene. InChIKey: SELSXVIZHNFFRV-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl |
|---|---|
| Molecular weight | 210.74 g/mol |
| IUPAC name | 5-tert-butyl-2-(chloromethyl)-1,3-dimethylbenzene |
| InChIKey | SELSXVIZHNFFRV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CCl)C)C(C)(C)C |
Computed by PubChem (NCBI)