CAS 1227935-03-6 is the registry number for 2-Bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (CAS 1227935-03-6) is a chemical compound with the molecular formula C5HBrF3NO3 and a molecular weight of 259.97 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid. InChIKey: HCMLCBSGXFOZIX-UHFFFAOYSA-N.
| Molecular formula | C5HBrF3NO3 |
|---|---|
| Molecular weight | 259.97 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| InChIKey | HCMLCBSGXFOZIX-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(O1)Br)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)