Products 1240605-58-6

CAS 1240605-58-6 is the registry number for 5-Bromo-2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-bromo-2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 1240605-58-6) is a chemical compound with the molecular formula C5HBrF3NO3 and a molecular weight of 259.97 g/mol. IUPAC name: 5-bromo-2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: MJSVAKMLDOHRDG-UHFFFAOYSA-N.

Identity
Molecular formulaC5HBrF3NO3
Molecular weight259.97 g/mol
IUPAC name5-bromo-2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid
InChIKeyMJSVAKMLDOHRDG-UHFFFAOYSA-N
SMILESC1(=C(OC(=N1)C(F)(F)F)Br)C(=O)O

Computed by PubChem (NCBI)