Products 1227954-99-5
CAS 1227954-99-5 appears in our catalog under these names: 6-Iodo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid, 95%, 6-Iodo-8-methylimidazo(1,2-a)pyridine-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
6-iodo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 1227954-99-5) is a chemical compound with the molecular formula C9H7IN2O2 and a molecular weight of 302.07 g/mol. IUPAC name: 6-iodo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: KARXPPYIHLCQEW-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2O2 |
|---|---|
| Molecular weight | 302.07 g/mol |
| IUPAC name | 6-iodo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | KARXPPYIHLCQEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2)C(=O)O)I |
Computed by PubChem (NCBI)