CAS 1822851-54-6 is the registry number for 6-Iodo-imidazo[1,2-a]pyridine-8-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 6-iodoimidazo[1,2-a]pyridine-8-carboxylate (CAS 1822851-54-6) is a chemical compound with the molecular formula C9H7IN2O2 and a molecular weight of 302.07 g/mol. IUPAC name: methyl 6-iodoimidazo[1,2-a]pyridine-8-carboxylate. InChIKey: PBMAARVZAYUMLH-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2O2 |
|---|---|
| Molecular weight | 302.07 g/mol |
| IUPAC name | methyl 6-iodoimidazo[1,2-a]pyridine-8-carboxylate |
| InChIKey | PBMAARVZAYUMLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN2C1=NC=C2)I |
Computed by PubChem (NCBI)