CAS 1228014-19-4 appears in our catalog under these names: 7-Bromo-1-ethyl-3,4-dihydropyrazino[2,3-b]pyrazin-2(1H)-one, 98%, 7-Bromo-1-ethyl-3,4-dihydropyrazino[2,3-b]pyrazin-2(1H)-one, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
3-bromo-5-ethyl-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (CAS 1228014-19-4) is a chemical compound with the molecular formula C8H9BrN4O and a molecular weight of 257.09 g/mol. IUPAC name: 3-bromo-5-ethyl-7,8-dihydropyrazino[2,3-b]pyrazin-6-one. InChIKey: NJTBQTUBDFATFP-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN4O |
|---|---|
| Molecular weight | 257.09 g/mol |
| IUPAC name | 3-bromo-5-ethyl-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| InChIKey | NJTBQTUBDFATFP-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)CNC2=NC=C(N=C21)Br |
Computed by PubChem (NCBI)