CAS 1824622-79-8 is the registry number for 2-(1-Aminoethyl)-5-bromopyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-aminoethyl)-5-bromo-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 1824622-79-8) is a chemical compound with the molecular formula C8H9BrN4O and a molecular weight of 257.09 g/mol. IUPAC name: 2-(1-aminoethyl)-5-bromo-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: NXNAZBQSLHMPJT-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN4O |
|---|---|
| Molecular weight | 257.09 g/mol |
| IUPAC name | 2-(1-aminoethyl)-5-bromo-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | NXNAZBQSLHMPJT-UHFFFAOYSA-N |
| SMILES | CC(C1=NN2C=CC(=C2C(=O)N1)Br)N |
Computed by PubChem (NCBI)