Products 122806-25-1
CAS 122806-25-1 appears in our catalog under these names: 1-(3-Methoxy-phenyl)-ethanone oxime, 95-<97%, 3-methoxyacetophenone oxime, 97%, 97%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g, 1g.
(NE)-N-[1-(3-methoxyphenyl)ethylidene]hydroxylamine (CAS 122806-25-1) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: (NE)-N-[1-(3-methoxyphenyl)ethylidene]hydroxylamine. InChIKey: PHQAPZHVNJXUSH-JXMROGBWSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | (NE)-N-[1-(3-methoxyphenyl)ethylidene]hydroxylamine |
| InChIKey | PHQAPZHVNJXUSH-JXMROGBWSA-N |
| SMILES | C/C(=N\O)/C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)