CAS 1228108-62-0 is the registry number for rel-(3R,4S)-1-Benzyl-4-(2-(benzyloxy)phenyl)pyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-4-(2-phenylmethoxyphenyl)pyrrolidin-3-amine (CAS 1228108-62-0) is a chemical compound with the molecular formula C24H26N2O and a molecular weight of 358.5 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-(2-phenylmethoxyphenyl)pyrrolidin-3-amine. InChIKey: HDXCFSZTXDWCBZ-PKTZIBPZSA-N.
| Molecular formula | C24H26N2O |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-(2-phenylmethoxyphenyl)pyrrolidin-3-amine |
| InChIKey | HDXCFSZTXDWCBZ-PKTZIBPZSA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)N)C3=CC=CC=C3OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)