CAS 1611481-35-6 is the registry number for ((2S,4R)-4-Amino-1-tritylpyrrolidin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4R)-4-amino-1-tritylpyrrolidin-2-yl]methanol (CAS 1611481-35-6) is a chemical compound with the molecular formula C24H26N2O and a molecular weight of 358.5 g/mol. IUPAC name: [(2S,4R)-4-amino-1-tritylpyrrolidin-2-yl]methanol. InChIKey: KKXQYTIVFITXEH-PKTZIBPZSA-N.
| Molecular formula | C24H26N2O |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | [(2S,4R)-4-amino-1-tritylpyrrolidin-2-yl]methanol |
| InChIKey | KKXQYTIVFITXEH-PKTZIBPZSA-N |
| SMILES | C1[C@H](CN([C@@H]1CO)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)