Products 1228181-20-1
CAS 1228181-20-1 appears in our catalog under these names: (4-(2-(Dimethylamino)-2-oxoethyl)phenyl)boronic acid, 95+%, 95+%, (4-(2-(Dimethylamino)-2-oxoethyl)phenyl)boronic acid, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-[2-(dimethylamino)-2-oxoethyl]phenyl]boronic acid (CAS 1228181-20-1) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [4-[2-(dimethylamino)-2-oxoethyl]phenyl]boronic acid. InChIKey: WIOUZWFGTCIABA-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [4-[2-(dimethylamino)-2-oxoethyl]phenyl]boronic acid |
| InChIKey | WIOUZWFGTCIABA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)