Products 1228181-35-8
CAS 1228181-35-8 is the registry number for 3-Chloro-4-(cyclopropylmethoxy)phenylboronic acid, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
[3-chloro-4-(cyclopropylmethoxy)phenyl]boronic acid (CAS 1228181-35-8) is a chemical compound with the molecular formula C10H12BClO3 and a molecular weight of 226.46 g/mol. IUPAC name: [3-chloro-4-(cyclopropylmethoxy)phenyl]boronic acid. InChIKey: YLVUHBXIJHCZOU-UHFFFAOYSA-N.
| Molecular formula | C10H12BClO3 |
|---|---|
| Molecular weight | 226.46 g/mol |
| IUPAC name | [3-chloro-4-(cyclopropylmethoxy)phenyl]boronic acid |
| InChIKey | YLVUHBXIJHCZOU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2CC2)Cl)(O)O |
Computed by PubChem (NCBI)