CAS 2225178-55-0 is the registry number for 2–Chloro–4–methoxy–5–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-chloro-5-cyclopropyl-4-methoxyphenyl)boronic acid (CAS 2225178-55-0) is a chemical compound with the molecular formula C10H12BClO3 and a molecular weight of 226.46 g/mol. IUPAC name: (2-chloro-5-cyclopropyl-4-methoxyphenyl)boronic acid. InChIKey: ASNBLGQHHMKUTG-UHFFFAOYSA-N.
| Molecular formula | C10H12BClO3 |
|---|---|
| Molecular weight | 226.46 g/mol |
| IUPAC name | (2-chloro-5-cyclopropyl-4-methoxyphenyl)boronic acid |
| InChIKey | ASNBLGQHHMKUTG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)OC)C2CC2)(O)O |
Computed by PubChem (NCBI)