CAS 1228182-49-7 appears in our catalog under these names: Oxfendazole EP Impurity B-d3 (Fenbendazole Sulfone-d3) , Fenbendazole Sulfone-d3, >95% (HPLC), D3-Fenbendazole-sulfone, Concentration: 100 µg/ml Solvent: Methanol, D3-Fenbendazole-sulfone. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 1x1ml, 1x10mg.
Trideuteriomethyl N-[6-(benzenesulfonyl)-1H-benzimidazol-2-yl]carbamate (CAS 1228182-49-7) is a chemical compound with the molecular formula C15H13N3O4S and a molecular weight of 334.4 g/mol. IUPAC name: trideuteriomethyl N-[6-(benzenesulfonyl)-1H-benzimidazol-2-yl]carbamate. InChIKey: UAFDGCOOJPIAHN-FIBGUPNXSA-N.
| Molecular formula | C15H13N3O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | trideuteriomethyl N-[6-(benzenesulfonyl)-1H-benzimidazol-2-yl]carbamate |
| InChIKey | UAFDGCOOJPIAHN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)