Products 1322262-99-6
CAS 1322262-99-6 is the registry number for MetRS-IN-1. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
4-[(E)-[[2-(thiophene-2-carbonylamino)acetyl]hydrazinylidene]methyl]benzoic acid (CAS 1322262-99-6) is a chemical compound with the molecular formula C15H13N3O4S and a molecular weight of 331.3 g/mol. IUPAC name: 4-[(E)-[[2-(thiophene-2-carbonylamino)acetyl]hydrazinylidene]methyl]benzoic acid. InChIKey: KMWOUFLMUAYYDF-CAOOACKPSA-N.
| Molecular formula | C15H13N3O4S |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | 4-[(E)-[[2-(thiophene-2-carbonylamino)acetyl]hydrazinylidene]methyl]benzoic acid |
| InChIKey | KMWOUFLMUAYYDF-CAOOACKPSA-N |
| SMILES | C1=CSC(=C1)C(=O)NCC(=O)N/N=C/C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)