Products 1228182-51-1
CAS 1228182-51-1 appears in our catalog under these names: Pefloxacin–d5, Pefloxacin-d5, 98.33%, D5-Pefloxacin, Concentration: 100 µg/ml Solvent: Acetonitrile, D5-Pefloxacin. Offered by: GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 5mg, 1 mg, 10 mg, 5 mg, 1x1ml, 1x10mg.
6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)quinoline-3-carboxylic acid (CAS 1228182-51-1) is a chemical compound with the molecular formula C17H20FN3O3 and a molecular weight of 338.39 g/mol. IUPAC name: 6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)quinoline-3-carboxylic acid. InChIKey: FHFYDNQZQSQIAI-WNWXXORZSA-N.
| Molecular formula | C17H20FN3O3 |
|---|---|
| Molecular weight | 338.39 g/mol |
| IUPAC name | 6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)quinoline-3-carboxylic acid |
| InChIKey | FHFYDNQZQSQIAI-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O |
Computed by PubChem (NCBI)