CAS 1228182-54-4 appears in our catalog under these names: Oxfendazole-d3, Fenbendazole Sulfoxide-d3, >95% (HPLC), Oxfendazole D3, Oxfendazole D3 100 µg/mL in Acetonitrile, D3-Oxfendazole, Concentration: 100 µg/ml Solvent: Methanol. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 1ml, 1x1ml, 1x10mg.
Trideuteriomethyl N-[6-(benzenesulfinyl)-1H-benzimidazol-2-yl]carbamate (CAS 1228182-54-4) is a chemical compound with the molecular formula C15H13N3O3S and a molecular weight of 318.4 g/mol. IUPAC name: trideuteriomethyl N-[6-(benzenesulfinyl)-1H-benzimidazol-2-yl]carbamate. InChIKey: BEZZFPOZAYTVHN-FIBGUPNXSA-N.
| Molecular formula | C15H13N3O3S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | trideuteriomethyl N-[6-(benzenesulfinyl)-1H-benzimidazol-2-yl]carbamate |
| InChIKey | BEZZFPOZAYTVHN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)S(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)