CAS 388626-12-8 appears in our catalog under these names: TrkA Inhibitor, ≥97%, sum of two isomers, ≥97%, sum of two isomers, TrkA Inhibitor. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, Get quote.
4-[(2-hydroxy-1H-indol-3-yl)methylideneamino]benzenesulfonamide (CAS 388626-12-8) is a chemical compound with the molecular formula C15H13N3O3S and a molecular weight of 315.3 g/mol. IUPAC name: 4-[(2-hydroxy-1H-indol-3-yl)methylideneamino]benzenesulfonamide. InChIKey: NCJKZPXFXOMPSP-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3S |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 4-[(2-hydroxy-1H-indol-3-yl)methylideneamino]benzenesulfonamide |
| InChIKey | NCJKZPXFXOMPSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)C=NC3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)