CAS 1228182-97-5 is the registry number for (4-(1H-1,2,3-Triazol-1-yl)phenyl)boronic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
[4-(triazol-1-yl)phenyl]boronic acid (CAS 1228182-97-5) is a chemical compound with the molecular formula C8H8BN3O2 and a molecular weight of 188.98 g/mol. IUPAC name: [4-(triazol-1-yl)phenyl]boronic acid. InChIKey: JGDSXNDHLOAJHG-UHFFFAOYSA-N.
| Molecular formula | C8H8BN3O2 |
|---|---|
| Molecular weight | 188.98 g/mol |
| IUPAC name | [4-(triazol-1-yl)phenyl]boronic acid |
| InChIKey | JGDSXNDHLOAJHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2C=CN=N2)(O)O |
Computed by PubChem (NCBI)