CAS 1228284-78-3 appears in our catalog under these names: 2,4,6-Trichloro-N-methoxy-Alpha-methylbenzeneethanamine, 2,4,6-Trichloro-N-methoxy-a-methylbenzeneethanamine. Offered by: TRC. Available pack sizes: 10mg, 1mg, 50mg.
N-methoxy-1-(2,4,6-trichlorophenyl)propan-2-amine (CAS 1228284-78-3) is a chemical compound with the molecular formula C10H12Cl3NO and a molecular weight of 268.6 g/mol. IUPAC name: N-methoxy-1-(2,4,6-trichlorophenyl)propan-2-amine. InChIKey: YEYSNJKFDGOAAP-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3NO |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | N-methoxy-1-(2,4,6-trichlorophenyl)propan-2-amine |
| InChIKey | YEYSNJKFDGOAAP-UHFFFAOYSA-N |
| SMILES | CC(CC1=C(C=C(C=C1Cl)Cl)Cl)NOC |
Computed by PubChem (NCBI)