CAS 1251033-61-0 is the registry number for 2-(3,4-Dichlorophenyl)morpholine hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3,4-dichlorophenyl)morpholine;hydrochloride (CAS 1251033-61-0) is a chemical compound with the molecular formula C10H12Cl3NO and a molecular weight of 268.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)morpholine;hydrochloride. InChIKey: AXBRXQCZKMVDIC-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3NO |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)morpholine;hydrochloride |
| InChIKey | AXBRXQCZKMVDIC-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)