CAS 1228556-76-0 is the registry number for (S)-1-(2-Bromo-5-fluorophenyl)ethan-1-amine, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2-bromo-5-fluorophenyl)ethanamine (CAS 1228556-76-0) is a chemical compound with the molecular formula C8H9BrFN and a molecular weight of 218.07 g/mol. IUPAC name: (1S)-1-(2-bromo-5-fluorophenyl)ethanamine. InChIKey: CQRICPAZGLNNEM-YFKPBYRVSA-N.
| Molecular formula | C8H9BrFN |
|---|---|
| Molecular weight | 218.07 g/mol |
| IUPAC name | (1S)-1-(2-bromo-5-fluorophenyl)ethanamine |
| InChIKey | CQRICPAZGLNNEM-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)F)Br)N |
Computed by PubChem (NCBI)