Products 1228569-39-8
CAS 1228569-39-8 is the registry number for (S)-2-(1-AMINOETHYL)-4-CHLOROPHENOL, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
2-[(1S)-1-aminoethyl]-4-chlorophenol (CAS 1228569-39-8) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-4-chlorophenol. InChIKey: IHDFZQZUBQSKDM-YFKPBYRVSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-4-chlorophenol |
| InChIKey | IHDFZQZUBQSKDM-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)Cl)O)N |
Computed by PubChem (NCBI)