CAS 1228603-77-7 is the registry number for (3,4)-Cis-benzyl 4-(aminomethyl)-3-fluoropiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate (CAS 1228603-77-7) is a chemical compound with the molecular formula C14H19FN2O2 and a molecular weight of 266.31 g/mol. IUPAC name: benzyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate. InChIKey: IOUYHTQXIPFYKF-STQMWFEESA-N.
| Molecular formula | C14H19FN2O2 |
|---|---|
| Molecular weight | 266.31 g/mol |
| IUPAC name | benzyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate |
| InChIKey | IOUYHTQXIPFYKF-STQMWFEESA-N |
| SMILES | C1CN(C[C@@H]([C@@H]1CN)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)